C35H46ClFN6O7 — CID 142409035
4-[2-amino-9-[(4-fluorophenyl)methyl]-6-oxo-1H-purin-8-yl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzamide (PubChem CID 142409035) has the molecular formula C35H46ClFN6O7 and a molecular weight of 717.24 g/mol. Its IUPAC name is 4-[2-amino-9-[(4-fluorophenyl)methyl]-6-oxo-1H-purin-8-yl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzamide.
| Compound Name | 4-[2-amino-9-[(4-fluorophenyl)methyl]-6-oxo-1H-purin-8-yl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
|---|---|
| PubChem CID | 142409035 |
| Molecular Formula | C35H46ClFN6O7 |
| Molecular Weight | 717.24 g/mol |
| Exact Mass | 716.31 |
| IUPAC Name | 4-[2-amino-9-[(4-fluorophenyl)methyl]-6-oxo-1H-purin-8-yl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]benzamide |
| SMILES | Nc1nc2c(nc(-c3ccc(C(=O)NCCOCCOCCOCCOCCOCCCCCCCl)cc3)n2Cc2ccc(F)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C35H46ClFN6O7/c36-13-3-1-2-4-15-46-17-19-48-21-23-50-24-22-49-20-18-47-16-14-39-33(44)28-9-7-27(8-10-28)31-40-30-32(41-35(38)42-34(30)45)43(31)25-26-5-11-29(37)12-6-26/h5-12H,1-4,13-25H2,(H,39,44)(H3,38,41,42,45) |
| InChIKey | IRTGAIDBASQTRW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 164.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.24 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|