C32H54ClN7O8S — CID 146634471
(2R)-2-acetamido-3-[(2-amino-9-cyclohexyl-6-oxo-1H-purin-8-yl)sulfanyl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide (PubChem CID 146634471) has the molecular formula C32H54ClN7O8S and a molecular weight of 732.34 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[(2-amino-9-cyclohexyl-6-oxo-1H-purin-8-yl)sulfanyl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide.
| Compound Name | (2R)-2-acetamido-3-[(2-amino-9-cyclohexyl-6-oxo-1H-purin-8-yl)sulfanyl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
|---|---|
| PubChem CID | 146634471 |
| Molecular Formula | C32H54ClN7O8S |
| Molecular Weight | 732.34 g/mol |
| Exact Mass | 731.34 |
| IUPAC Name | (2R)-2-acetamido-3-[(2-amino-9-cyclohexyl-6-oxo-1H-purin-8-yl)sulfanyl]-N-[2-[2-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]propanamide |
| SMILES | CC(=O)N[C@@H](CSc1nc2c(=O)[nH]c(N)nc2n1C1CCCCC1)C(=O)NCCOCCOCCOCCOCCOCCCCCCCl |
| InChI | InChI=1S/C32H54ClN7O8S/c1-24(41)36-26(23-49-32-37-27-28(38-31(34)39-30(27)43)40(32)25-9-5-4-6-10-25)29(42)35-12-14-45-16-18-47-20-22-48-21-19-46-17-15-44-13-8-3-2-7-11-33/h25-26H,2-23H2,1H3,(H,35,42)(H,36,41)(H3,34,38,39,43)/t26-/m0/s1 |
| InChIKey | OSLQTIWISRZHAB-SANMLTNESA-N |
| XLogP | 2.80 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|