C13H16F2N6O2 — CID 175788875
2-amino-8-cyclopentyl-6-(2,2-difluoroethylamino)-3H-pteridine-4,7-dione (PubChem CID 175788875) has the molecular formula C13H16F2N6O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 2-amino-8-cyclopentyl-6-(2,2-difluoroethylamino)-3H-pteridine-4,7-dione.
| Compound Name | 2-amino-8-cyclopentyl-6-(2,2-difluoroethylamino)-3H-pteridine-4,7-dione |
|---|---|
| PubChem CID | 175788875 |
| Molecular Formula | C13H16F2N6O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 2-amino-8-cyclopentyl-6-(2,2-difluoroethylamino)-3H-pteridine-4,7-dione |
| SMILES | Nc1nc2c(nc(NCC(F)F)c(=O)n2C2CCCC2)c(=O)[nH]1 |
| InChI | InChI=1S/C13H16F2N6O2/c14-7(15)5-17-9-12(23)21(6-3-1-2-4-6)10-8(18-9)11(22)20-13(16)19-10/h6-7H,1-5H2,(H,17,18)(H3,16,19,20,22) |
| InChIKey | BWPKCBNDAVHNHT-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |