C9H10BrN5O2 — CID 137316308
2-amino-8-bromo-9-(oxolan-2-yl)-1H-purin-6-one (PubChem CID 137316308) has the molecular formula C9H10BrN5O2 and a molecular weight of 300.12 g/mol. Its IUPAC name is 2-amino-8-bromo-9-(oxolan-2-yl)-1H-purin-6-one.
| Compound Name | 2-amino-8-bromo-9-(oxolan-2-yl)-1H-purin-6-one |
|---|---|
| PubChem CID | 137316308 |
| Molecular Formula | C9H10BrN5O2 |
| Molecular Weight | 300.12 g/mol |
| Exact Mass | 299.00 |
| IUPAC Name | 2-amino-8-bromo-9-(oxolan-2-yl)-1H-purin-6-one |
| SMILES | Nc1nc2c(nc(Br)n2C2CCCO2)c(=O)[nH]1 |
| InChI | InChI=1S/C9H10BrN5O2/c10-8-12-5-6(13-9(11)14-7(5)16)15(8)4-2-1-3-17-4/h4H,1-3H2,(H3,11,13,14,16) |
| InChIKey | IBDPAWDPXWOVDI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.12 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |