C24H26N4O3S — CID 135499904
9-benzyl-8-benzylsulfanyl-2-(diethoxymethyl)-1H-purin-6-one (PubChem CID 135499904) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is 9-benzyl-8-benzylsulfanyl-2-(diethoxymethyl)-1H-purin-6-one.
| Compound Name | 9-benzyl-8-benzylsulfanyl-2-(diethoxymethyl)-1H-purin-6-one |
|---|---|
| PubChem CID | 135499904 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | 9-benzyl-8-benzylsulfanyl-2-(diethoxymethyl)-1H-purin-6-one |
| SMILES | CCOC(OCC)c1nc2c(nc(SCc3ccccc3)n2Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C24H26N4O3S/c1-3-30-23(31-4-2)20-26-21-19(22(29)27-20)25-24(32-16-18-13-9-6-10-14-18)28(21)15-17-11-7-5-8-12-17/h5-14,23H,3-4,15-16H2,1-2H3,(H,26,27,29) |
| InChIKey | VBTMKNIISPAAIL-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|