C16H19N5O3 — CID 135818448
3-benzyl-5-(diethoxymethyl)-6H-triazolo[4,5-d]pyrimidin-7-one (PubChem CID 135818448) has the molecular formula C16H19N5O3 and a molecular weight of 329.36 g/mol. Its IUPAC name is 3-benzyl-5-(diethoxymethyl)-6H-triazolo[4,5-d]pyrimidin-7-one.
| Compound Name | 3-benzyl-5-(diethoxymethyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 135818448 |
| Molecular Formula | C16H19N5O3 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 3-benzyl-5-(diethoxymethyl)-6H-triazolo[4,5-d]pyrimidin-7-one |
| SMILES | CCOC(OCC)c1nc2c(nnn2Cc2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C16H19N5O3/c1-3-23-16(24-4-2)13-17-14-12(15(22)18-13)19-20-21(14)10-11-8-6-5-7-9-11/h5-9,16H,3-4,10H2,1-2H3,(H,17,18,22) |
| InChIKey | DSDXQPHWULAKDU-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|