C10H11N5O4 — CID 136842155
(1R,13R,14S)-5-amino-14-hydroxy-11,16-dioxa-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3(8),4,9-trien-7-one (PubChem CID 136842155) has the molecular formula C10H11N5O4 and a molecular weight of 265.23 g/mol. Its IUPAC name is (1R,13R,14S)-5-amino-14-hydroxy-11,16-dioxa-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3(8),4,9-trien-7-one.
| Compound Name | (1R,13R,14S)-5-amino-14-hydroxy-11,16-dioxa-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3(8),4,9-trien-7-one |
|---|---|
| PubChem CID | 136842155 |
| Molecular Formula | C10H11N5O4 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | (1R,13R,14S)-5-amino-14-hydroxy-11,16-dioxa-2,4,6,9-tetrazatetracyclo[11.2.1.02,10.03,8]hexadeca-3(8),4,9-trien-7-one |
| SMILES | Nc1nc2c(nc3n2[C@H]2C[C@H](O)[C@@H](CO3)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C10H11N5O4/c11-9-13-7-6(8(17)14-9)12-10-15(7)5-1-3(16)4(19-5)2-18-10/h3-5,16H,1-2H2,(H3,11,13,14,17)/t3-,4+,5+/m0/s1 |
| InChIKey | MUSATXBRCHRICY-VPENINKCSA-N |
| XLogP | -1.26 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |