C12H16N5O8P — CID 137348489
[(5R)-5-(2-amino-6-methyl-4,7-dioxo-3H-pteridin-8-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 137348489) has the molecular formula C12H16N5O8P and a molecular weight of 389.26 g/mol. Its IUPAC name is [(5R)-5-(2-amino-6-methyl-4,7-dioxo-3H-pteridin-8-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(5R)-5-(2-amino-6-methyl-4,7-dioxo-3H-pteridin-8-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 137348489 |
| Molecular Formula | C12H16N5O8P |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [(5R)-5-(2-amino-6-methyl-4,7-dioxo-3H-pteridin-8-yl)-3-hydroxyoxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | Cc1nc2c(=O)[nH]c(N)nc2n([C@H]2CC(O)C(COP(=O)(O)O)O2)c1=O |
| InChI | InChI=1S/C12H16N5O8P/c1-4-11(20)17(9-8(14-4)10(19)16-12(13)15-9)7-2-5(18)6(25-7)3-24-26(21,22)23/h5-7,18H,2-3H2,1H3,(H2,21,22,23)(H3,13,15,16,19)/t5?,6?,7-/m1/s1 |
| InChIKey | ZHNPRYPLFLWMLI-KPGICGJXSA-N |
| XLogP | -1.87 |
| TPSA | 202.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | -1.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|