C12H17N7O4 — CID 137348200
2-[[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-[(2S)-2-aminopropyl]amino]acetic acid (PubChem CID 137348200) has the molecular formula C12H17N7O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-[(2S)-2-aminopropyl]amino]acetic acid.
| Compound Name | 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-[(2S)-2-aminopropyl]amino]acetic acid |
|---|---|
| PubChem CID | 137348200 |
| Molecular Formula | C12H17N7O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 2-[[2-(2-amino-6-oxo-1H-purin-9-yl)acetyl]-[(2S)-2-aminopropyl]amino]acetic acid |
| SMILES | C[C@H](N)CN(CC(=O)O)C(=O)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C12H17N7O4/c1-6(13)2-18(4-8(21)22)7(20)3-19-5-15-9-10(19)16-12(14)17-11(9)23/h5-6H,2-4,13H2,1H3,(H,21,22)(H3,14,16,17,23)/t6-/m0/s1 |
| InChIKey | KMNPWJULLUAIHL-LURJTMIESA-N |
| XLogP | -2.04 |
| TPSA | 173.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |