C13H19N7O3 — CID 166164333
2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide (PubChem CID 166164333) has the molecular formula C13H19N7O3 and a molecular weight of 321.34 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide |
|---|---|
| PubChem CID | 166164333 |
| Molecular Formula | C13H19N7O3 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide |
| SMILES | CNCCN(CC(C)=O)C(=O)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C13H19N7O3/c1-8(21)5-19(4-3-15-2)9(22)6-20-7-16-10-11(20)17-13(14)18-12(10)23/h7,15H,3-6H2,1-2H3,(H3,14,17,18,23) |
| InChIKey | WBVONLVHYGNXIK-UHFFFAOYSA-N |
| XLogP | -1.66 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |