C14H21N7O3 — CID 160551084
N-[2-(methylamino)ethyl]-2-[2-(methylamino)-6-oxo-1H-purin-9-yl]-N-(2-oxopropyl)acetamide (PubChem CID 160551084) has the molecular formula C14H21N7O3 and a molecular weight of 335.37 g/mol. Its IUPAC name is N-[2-(methylamino)ethyl]-2-[2-(methylamino)-6-oxo-1H-purin-9-yl]-N-(2-oxopropyl)acetamide.
| Compound Name | N-[2-(methylamino)ethyl]-2-[2-(methylamino)-6-oxo-1H-purin-9-yl]-N-(2-oxopropyl)acetamide |
|---|---|
| PubChem CID | 160551084 |
| Molecular Formula | C14H21N7O3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | N-[2-(methylamino)ethyl]-2-[2-(methylamino)-6-oxo-1H-purin-9-yl]-N-(2-oxopropyl)acetamide |
| SMILES | CNCCN(CC(C)=O)C(=O)Cn1cnc2c(=O)[nH]c(NC)nc21 |
| InChI | InChI=1S/C14H21N7O3/c1-9(22)6-20(5-4-15-2)10(23)7-21-8-17-11-12(21)18-14(16-3)19-13(11)24/h8,15H,4-7H2,1-3H3,(H2,16,18,19,24) |
| InChIKey | QYBSYYQNKOWIDJ-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |