C13H21N8O3P — CID 143862992
2-[2-(methylamino)ethyl-[2-[2-(methylamino)-6-(phosphanylamino)purin-9-yl]acetyl]amino]acetic acid (PubChem CID 143862992) has the molecular formula C13H21N8O3P and a molecular weight of 368.34 g/mol. Its IUPAC name is 2-[2-(methylamino)ethyl-[2-[2-(methylamino)-6-(phosphanylamino)purin-9-yl]acetyl]amino]acetic acid.
| Compound Name | 2-[2-(methylamino)ethyl-[2-[2-(methylamino)-6-(phosphanylamino)purin-9-yl]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 143862992 |
| Molecular Formula | C13H21N8O3P |
| Molecular Weight | 368.34 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | 2-[2-(methylamino)ethyl-[2-[2-(methylamino)-6-(phosphanylamino)purin-9-yl]acetyl]amino]acetic acid |
| SMILES | CNCCN(CC(=O)O)C(=O)Cn1cnc2c(NP)nc(NC)nc21 |
| InChI | InChI=1S/C13H21N8O3P/c1-14-3-4-20(6-9(23)24)8(22)5-21-7-16-10-11(19-25)17-13(15-2)18-12(10)21/h7,14H,3-6,25H2,1-2H3,(H,23,24)(H2,15,17,18,19) |
| InChIKey | HWPBUGHXEIQKOA-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.34 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|