C15H25N7O3 — CID 166164332
2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide;ethane (PubChem CID 166164332) has the molecular formula C15H25N7O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide;ethane.
| Compound Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide;ethane |
|---|---|
| PubChem CID | 166164332 |
| Molecular Formula | C15H25N7O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 2-(2-amino-6-oxo-1H-purin-9-yl)-N-[2-(methylamino)ethyl]-N-(2-oxopropyl)acetamide;ethane |
| SMILES | CC.CNCCN(CC(C)=O)C(=O)Cn1cnc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C13H19N7O3.C2H6/c1-8(21)5-19(4-3-15-2)9(22)6-20-7-16-10-11(20)17-13(14)18-12(10)23;1-2/h7,15H,3-6H2,1-2H3,(H3,14,17,18,23);1-2H3 |
| InChIKey | PQCHYVCUDDFIGZ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 139.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |