C7H11N5O9P2 — CID 135764586
2-amino-6-(hydroxymethyl)-3H-pteridin-4-one;phosphono dihydrogen phosphate (PubChem CID 135764586) has the molecular formula C7H11N5O9P2 and a molecular weight of 371.14 g/mol. Its IUPAC name is 2-amino-6-(hydroxymethyl)-3H-pteridin-4-one;phosphono dihydrogen phosphate.
| Compound Name | 2-amino-6-(hydroxymethyl)-3H-pteridin-4-one;phosphono dihydrogen phosphate |
|---|---|
| PubChem CID | 135764586 |
| Molecular Formula | C7H11N5O9P2 |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 2-amino-6-(hydroxymethyl)-3H-pteridin-4-one;phosphono dihydrogen phosphate |
| SMILES | Nc1nc2ncc(CO)nc2c(=O)[nH]1.O=P(O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C7H7N5O2.H4O7P2/c8-7-11-5-4(6(14)12-7)10-3(2-13)1-9-5;1-8(2,3)7-9(4,5)6/h1,13H,2H2,(H3,8,9,11,12,14);(H2,1,2,3)(H2,4,5,6) |
| InChIKey | BMUHQUYGOJAYET-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 242.07 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|