C9H14N4O — CID 135420445
2,4-diamino-5-(3-methylbut-2-enyl)-1H-pyrimidin-6-one (PubChem CID 135420445) has the molecular formula C9H14N4O and a molecular weight of 194.24 g/mol. Its IUPAC name is 2,4-diamino-5-(3-methylbut-2-enyl)-1H-pyrimidin-6-one.
| Compound Name | 2,4-diamino-5-(3-methylbut-2-enyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135420445 |
| Molecular Formula | C9H14N4O |
| Molecular Weight | 194.24 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2,4-diamino-5-(3-methylbut-2-enyl)-1H-pyrimidin-6-one |
| SMILES | CC(C)=CCc1c(N)nc(N)[nH]c1=O |
| InChI | InChI=1S/C9H14N4O/c1-5(2)3-4-6-7(10)12-9(11)13-8(6)14/h3H,4H2,1-2H3,(H5,10,11,12,13,14) |
| InChIKey | RLKDSQJYYFVBLY-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 97.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.24 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|