C10H16N6 — CID 174749238
2-(3-methylbutyl)-7H-purine-6,8-diamine (PubChem CID 174749238) has the molecular formula C10H16N6 and a molecular weight of 220.28 g/mol. Its IUPAC name is 2-(3-methylbutyl)-7H-purine-6,8-diamine.
| Compound Name | 2-(3-methylbutyl)-7H-purine-6,8-diamine |
|---|---|
| PubChem CID | 174749238 |
| Molecular Formula | C10H16N6 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 2-(3-methylbutyl)-7H-purine-6,8-diamine |
| SMILES | CC(C)CCc1nc(N)c2[nH]c(N)nc2n1 |
| InChI | InChI=1S/C10H16N6/c1-5(2)3-4-6-13-8(11)7-9(14-6)16-10(12)15-7/h5H,3-4H2,1-2H3,(H5,11,12,13,14,15,16) |
| InChIKey | LRXFTWJZVGWGNG-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |