About N-butyl-7H-purin-6-amine
N-butyl-7H-purin-6-amine (PubChem CID 521516) has the molecular formula C9H13N5
and a molecular weight of 191.24 g/mol. Its IUPAC name is N-butyl-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-butyl-7H-purin-6-amine |
| PubChem CID | 521516 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-butyl-7H-purin-6-amine |
| SMILES | CCCCNc1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C9H13N5/c1-2-3-4-10-8-7-9(12-5-11-7)14-6-13-8/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14) |
| InChIKey | CRYKTDPNUYNOTI-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butyl-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-7H-purin-6-amine?
The IUPAC name of N-butyl-7H-purin-6-amine (CID 521516) is N-butyl-7H-purin-6-amine.
What is the SMILES notation for N-butyl-7H-purin-6-amine?
The canonical SMILES for N-butyl-7H-purin-6-amine is CCCCNc1ncnc2nc[nH]c12.
What is the InChIKey of N-butyl-7H-purin-6-amine?
The InChIKey is CRYKTDPNUYNOTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5/c1-2-3-4-10-8-7-9(12-5-11-7)14-6-13-8/h5-6H,2-4H2,1H3,(H2,10,11,12,13,14).
What are the key properties of N-butyl-7H-purin-6-amine?
N-butyl-7H-purin-6-amine has a molecular weight of 191.24 g/mol, XLogP of 1.56, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-7H-purin-6-amine is sourced from PubChem (CID 521516), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).