C15H17F3N4O — CID 135491140
2-amino-4-methyl-5-[3-[3-(trifluoromethyl)anilino]propyl]-1H-pyrimidin-6-one (PubChem CID 135491140) has the molecular formula C15H17F3N4O and a molecular weight of 326.32 g/mol. Its IUPAC name is 2-amino-4-methyl-5-[3-[3-(trifluoromethyl)anilino]propyl]-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-methyl-5-[3-[3-(trifluoromethyl)anilino]propyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135491140 |
| Molecular Formula | C15H17F3N4O |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 2-amino-4-methyl-5-[3-[3-(trifluoromethyl)anilino]propyl]-1H-pyrimidin-6-one |
| SMILES | Cc1nc(N)[nH]c(=O)c1CCCNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H17F3N4O/c1-9-12(13(23)22-14(19)21-9)6-3-7-20-11-5-2-4-10(8-11)15(16,17)18/h2,4-5,8,20H,3,6-7H2,1H3,(H3,19,21,22,23) |
| InChIKey | IVTCSFDEFPKANN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|