C15H12F3N3O4 — CID 139755616
6-[3-[3-(trifluoromethyl)anilino]propyl]imidazo[1,2-b][1,4,2]dioxazine-2,3-dione (PubChem CID 139755616) has the molecular formula C15H12F3N3O4 and a molecular weight of 355.27 g/mol. Its IUPAC name is 6-[3-[3-(trifluoromethyl)anilino]propyl]imidazo[1,2-b][1,4,2]dioxazine-2,3-dione.
| Compound Name | 6-[3-[3-(trifluoromethyl)anilino]propyl]imidazo[1,2-b][1,4,2]dioxazine-2,3-dione |
|---|---|
| PubChem CID | 139755616 |
| Molecular Formula | C15H12F3N3O4 |
| Molecular Weight | 355.27 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 6-[3-[3-(trifluoromethyl)anilino]propyl]imidazo[1,2-b][1,4,2]dioxazine-2,3-dione |
| SMILES | O=c1oc2nc(CCCNc3cccc(C(F)(F)F)c3)cn2oc1=O |
| InChI | InChI=1S/C15H12F3N3O4/c16-15(17,18)9-3-1-4-10(7-9)19-6-2-5-11-8-21-14(20-11)24-12(22)13(23)25-21/h1,3-4,7-8,19H,2,5-6H2 |
| InChIKey | UHDJTRZRMPJDAU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|