C15H22ClN5O3S — CID 135539664
4-(aminomethyl)-N-[3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propyl]benzenesulfonamide;hydrochloride (PubChem CID 135539664) has the molecular formula C15H22ClN5O3S and a molecular weight of 387.89 g/mol. Its IUPAC name is 4-(aminomethyl)-N-[3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propyl]benzenesulfonamide;hydrochloride.
| Compound Name | 4-(aminomethyl)-N-[3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propyl]benzenesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 135539664 |
| Molecular Formula | C15H22ClN5O3S |
| Molecular Weight | 387.89 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 4-(aminomethyl)-N-[3-(2-amino-4-methyl-6-oxo-1H-pyrimidin-5-yl)propyl]benzenesulfonamide;hydrochloride |
| SMILES | Cc1nc(N)[nH]c(=O)c1CCCNS(=O)(=O)c1ccc(CN)cc1.Cl |
| InChI | InChI=1S/C15H21N5O3S.ClH/c1-10-13(14(21)20-15(17)19-10)3-2-8-18-24(22,23)12-6-4-11(9-16)5-7-12;/h4-7,18H,2-3,8-9,16H2,1H3,(H3,17,19,20,21);1H |
| InChIKey | QCYSJUDQLKRIHE-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.89 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|