C19H26N4O4S — CID 131939568
3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]propanamide (PubChem CID 131939568) has the molecular formula C19H26N4O4S and a molecular weight of 406.51 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]propanamide |
|---|---|
| PubChem CID | 131939568 |
| Molecular Formula | C19H26N4O4S |
| Molecular Weight | 406.51 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[3-[(4-methylphenyl)sulfonylamino]propyl]propanamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNC(=O)CCc2c(C)nc(=O)[nH]c2C)cc1 |
| InChI | InChI=1S/C19H26N4O4S/c1-13-5-7-16(8-6-13)28(26,27)21-12-4-11-20-18(24)10-9-17-14(2)22-19(25)23-15(17)3/h5-8,21H,4,9-12H2,1-3H3,(H,20,24)(H,22,23,25) |
| InChIKey | YHMRIQWHLNEKEB-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.51 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|