C17H23N5O2 — CID 90647550
3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide (PubChem CID 90647550) has the molecular formula C17H23N5O2 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
|---|---|
| PubChem CID | 90647550 |
| Molecular Formula | C17H23N5O2 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.19 |
| IUPAC Name | 3-(4,6-dimethyl-2-oxo-1H-pyrimidin-5-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]propanamide |
| SMILES | Cc1cnccc1NCCNC(=O)CCc1c(C)nc(=O)[nH]c1C |
| InChI | InChI=1S/C17H23N5O2/c1-11-10-18-7-6-15(11)19-8-9-20-16(23)5-4-14-12(2)21-17(24)22-13(14)3/h6-7,10H,4-5,8-9H2,1-3H3,(H,18,19)(H,20,23)(H,21,22,24) |
| InChIKey | OGEYPPIQNOKGMK-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|