C18H22N4O — CID 131922886
2-(1,3-dihydroisoindol-2-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]acetamide (PubChem CID 131922886) has the molecular formula C18H22N4O and a molecular weight of 310.40 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]acetamide.
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 131922886 |
| Molecular Formula | C18H22N4O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)-N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]acetamide |
| SMILES | Cc1cnccc1NCCNC(=O)CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H22N4O/c1-14-10-19-7-6-17(14)20-8-9-21-18(23)13-22-11-15-4-2-3-5-16(15)12-22/h2-7,10H,8-9,11-13H2,1H3,(H,19,20)(H,21,23) |
| InChIKey | OJPFPEIPYVZFEI-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|