C12H17N3O — CID 62204635
N-(2-aminoethyl)-2-(1,3-dihydroisoindol-2-yl)acetamide (PubChem CID 62204635) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-(1,3-dihydroisoindol-2-yl)acetamide.
| Compound Name | N-(2-aminoethyl)-2-(1,3-dihydroisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 62204635 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-(2-aminoethyl)-2-(1,3-dihydroisoindol-2-yl)acetamide |
| SMILES | NCCNC(=O)CN1Cc2ccccc2C1 |
| InChI | InChI=1S/C12H17N3O/c13-5-6-14-12(16)9-15-7-10-3-1-2-4-11(10)8-15/h1-4H,5-9,13H2,(H,14,16) |
| InChIKey | HTGAAPFXSMFDMK-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |