C18H19N5O — CID 119074513
N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide (PubChem CID 119074513) has the molecular formula C18H19N5O and a molecular weight of 321.38 g/mol. Its IUPAC name is N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide.
| Compound Name | N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 119074513 |
| Molecular Formula | C18H19N5O |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | N-[2-[(3-methyl-4-pyridinyl)amino]ethyl]-1-phenylpyrazole-4-carboxamide |
| SMILES | Cc1cnccc1NCCNC(=O)c1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C18H19N5O/c1-14-11-19-8-7-17(14)20-9-10-21-18(24)15-12-22-23(13-15)16-5-3-2-4-6-16/h2-8,11-13H,9-10H2,1H3,(H,19,20)(H,21,24) |
| InChIKey | LWRLVEYVVDNRAQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|