C13H19ClN4O2 — CID 135539665
2-amino-5-[3-(furan-2-ylmethylamino)propyl]-4-methyl-1H-pyrimidin-6-one;hydrochloride (PubChem CID 135539665) has the molecular formula C13H19ClN4O2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-amino-5-[3-(furan-2-ylmethylamino)propyl]-4-methyl-1H-pyrimidin-6-one;hydrochloride.
| Compound Name | 2-amino-5-[3-(furan-2-ylmethylamino)propyl]-4-methyl-1H-pyrimidin-6-one;hydrochloride |
|---|---|
| PubChem CID | 135539665 |
| Molecular Formula | C13H19ClN4O2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-amino-5-[3-(furan-2-ylmethylamino)propyl]-4-methyl-1H-pyrimidin-6-one;hydrochloride |
| SMILES | Cc1nc(N)[nH]c(=O)c1CCCNCc1ccco1.Cl |
| InChI | InChI=1S/C13H18N4O2.ClH/c1-9-11(12(18)17-13(14)16-9)5-2-6-15-8-10-4-3-7-19-10;/h3-4,7,15H,2,5-6,8H2,1H3,(H3,14,16,17,18);1H |
| InChIKey | METDSJCLMPCRBA-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 96.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|