C9H17ClN2O3S — CID 115595242
N-[2-(furan-2-ylmethylamino)ethyl]ethanesulfonamide;hydrochloride (PubChem CID 115595242) has the molecular formula C9H17ClN2O3S and a molecular weight of 268.77 g/mol. Its IUPAC name is N-[2-(furan-2-ylmethylamino)ethyl]ethanesulfonamide;hydrochloride.
| Compound Name | N-[2-(furan-2-ylmethylamino)ethyl]ethanesulfonamide;hydrochloride |
|---|---|
| PubChem CID | 115595242 |
| Molecular Formula | C9H17ClN2O3S |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | N-[2-(furan-2-ylmethylamino)ethyl]ethanesulfonamide;hydrochloride |
| SMILES | CCS(=O)(=O)NCCNCc1ccco1.Cl |
| InChI | InChI=1S/C9H16N2O3S.ClH/c1-2-15(12,13)11-6-5-10-8-9-4-3-7-14-9;/h3-4,7,10-11H,2,5-6,8H2,1H3;1H |
| InChIKey | MOUMHZWDALXWDX-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|