C15H20N2O — CID 54809780
N'-(2,6-dimethylphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine (PubChem CID 54809780) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is N'-(2,6-dimethylphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine.
| Compound Name | N'-(2,6-dimethylphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 54809780 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | N'-(2,6-dimethylphenyl)-N-(furan-2-ylmethyl)ethane-1,2-diamine |
| SMILES | Cc1cccc(C)c1NCCNCc1ccco1 |
| InChI | InChI=1S/C15H20N2O/c1-12-5-3-6-13(2)15(12)17-9-8-16-11-14-7-4-10-18-14/h3-7,10,16-17H,8-9,11H2,1-2H3 |
| InChIKey | JBXFJXRSEQGRJO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|