C12H17ClN2OS — CID 115618496
2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride (PubChem CID 115618496) has the molecular formula C12H17ClN2OS and a molecular weight of 272.80 g/mol. Its IUPAC name is 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride.
| Compound Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 115618496 |
| Molecular Formula | C12H17ClN2OS |
| Molecular Weight | 272.80 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 2-(2,4-dimethyl-1,3-thiazol-5-yl)-N-(furan-2-ylmethyl)ethanamine;hydrochloride |
| SMILES | Cc1nc(C)c(CCNCc2ccco2)s1.Cl |
| InChI | InChI=1S/C12H16N2OS.ClH/c1-9-12(16-10(2)14-9)5-6-13-8-11-4-3-7-15-11;/h3-4,7,13H,5-6,8H2,1-2H3;1H |
| InChIKey | SLQIRCOWXHFRCK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.80 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|