C10H12N2OS — CID 9167847
N-(furan-2-ylmethyl)-4,5-dimethyl-1,3-thiazol-2-amine (PubChem CID 9167847) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4,5-dimethyl-1,3-thiazol-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-4,5-dimethyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 9167847 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-(furan-2-ylmethyl)-4,5-dimethyl-1,3-thiazol-2-amine |
| SMILES | Cc1nc(NCc2ccco2)sc1C |
| InChI | InChI=1S/C10H12N2OS/c1-7-8(2)14-10(12-7)11-6-9-4-3-5-13-9/h3-5H,6H2,1-2H3,(H,11,12) |
| InChIKey | QNXAXBLJLNPOET-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |