C14H14N2OS2 — CID 24505587
4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 24505587) has the molecular formula C14H14N2OS2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine.
| Compound Name | 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 24505587 |
| Molecular Formula | C14H14N2OS2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 4-(2,5-dimethylthiophen-3-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | Cc1cc(-c2csc(NCc3ccco3)n2)c(C)s1 |
| InChI | InChI=1S/C14H14N2OS2/c1-9-6-12(10(2)19-9)13-8-18-14(16-13)15-7-11-4-3-5-17-11/h3-6,8H,7H2,1-2H3,(H,15,16) |
| InChIKey | RNGPOAYKZQJRFM-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiazole_amine_C(3)', 'substructure': 'N/A'} |
|---|