About 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine
4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine (PubChem CID 17452911) has the molecular formula C15H12N2O3S
and a molecular weight of 300.34 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
| PubChem CID | 17452911 |
| Molecular Formula | C15H12N2O3S |
| Molecular Weight | 300.34 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine |
| SMILES | c1coc(CNc2nc(-c3ccc4c(c3)OCO4)cs2)c1 |
| InChI | InChI=1S/C15H12N2O3S/c1-2-11(18-5-1)7-16-15-17-12(8-21-15)10-3-4-13-14(6-10)20-9-19-13/h1-6,8H,7,9H2,(H,16,17) |
| InChIKey | HYBDZEVOLFYFBK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazole_amine_C(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine?
The IUPAC name of 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine (CID 17452911) is 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine.
What is the SMILES notation for 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine?
The canonical SMILES for 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine is c1coc(CNc2nc(-c3ccc4c(c3)OCO4)cs2)c1.
What is the InChIKey of 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine?
The InChIKey is HYBDZEVOLFYFBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O3S/c1-2-11(18-5-1)7-16-15-17-12(8-21-15)10-3-4-13-14(6-10)20-9-19-13/h1-6,8H,7,9H2,(H,16,17).
What are the key properties of 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine?
4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine has a molecular weight of 300.34 g/mol, XLogP of 3.74, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,3-benzodioxol-5-yl)-N-(furan-2-ylmethyl)-1,3-thiazol-2-amine is sourced from PubChem (CID 17452911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).