C10H8ClN3O — CID 135472873
3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135472873) has the molecular formula C10H8ClN3O and a molecular weight of 221.65 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135472873 |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-(4-chlorophenyl)-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccc(Cl)cc2)[nH]c1=O |
| InChI | InChI=1S/C10H8ClN3O/c1-6-10(15)12-9(14-13-6)7-2-4-8(11)5-3-7/h2-5H,1H3,(H,12,14,15) |
| InChIKey | BHFWVAOPSUWYHS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |