C10H9N3O — CID 135472887
6-methyl-3-phenyl-4H-1,2,4-triazin-5-one (PubChem CID 135472887) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 6-methyl-3-phenyl-4H-1,2,4-triazin-5-one.
| Compound Name | 6-methyl-3-phenyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135472887 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 6-methyl-3-phenyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccccc2)[nH]c1=O |
| InChI | InChI=1S/C10H9N3O/c1-7-10(14)11-9(13-12-7)8-5-3-2-4-6-8/h2-6H,1H3,(H,11,13,14) |
| InChIKey | GQOHHBLOVGBIIF-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |