C10H10N4O — CID 135783237
3-(2-aminophenyl)-6-methyl-4H-1,2,4-triazin-5-one (PubChem CID 135783237) has the molecular formula C10H10N4O and a molecular weight of 202.22 g/mol. Its IUPAC name is 3-(2-aminophenyl)-6-methyl-4H-1,2,4-triazin-5-one.
| Compound Name | 3-(2-aminophenyl)-6-methyl-4H-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 135783237 |
| Molecular Formula | C10H10N4O |
| Molecular Weight | 202.22 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | 3-(2-aminophenyl)-6-methyl-4H-1,2,4-triazin-5-one |
| SMILES | Cc1nnc(-c2ccccc2N)[nH]c1=O |
| InChI | InChI=1S/C10H10N4O/c1-6-10(15)12-9(14-13-6)7-4-2-3-5-8(7)11/h2-5H,11H2,1H3,(H,12,14,15) |
| InChIKey | GHPKGKUELOGSIW-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.22 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|