C12H11N5O3 — CID 115925725
8-(2-methoxy-3-pyridinyl)-3-methyl-7H-purine-2,6-dione (PubChem CID 115925725) has the molecular formula C12H11N5O3 and a molecular weight of 273.25 g/mol. Its IUPAC name is 8-(2-methoxy-3-pyridinyl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(2-methoxy-3-pyridinyl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 115925725 |
| Molecular Formula | C12H11N5O3 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 8-(2-methoxy-3-pyridinyl)-3-methyl-7H-purine-2,6-dione |
| SMILES | COc1ncccc1-c1nc2c([nH]1)c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C12H11N5O3/c1-17-9-7(10(18)16-12(17)19)14-8(15-9)6-4-3-5-13-11(6)20-2/h3-5H,1-2H3,(H,14,15)(H,16,18,19) |
| InChIKey | SKRCRRAJUMYONU-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |