C13H13N5O3 — CID 56855762
8-(2-methoxy-3-pyridinyl)-3,7-dimethylpurine-2,6-dione (PubChem CID 56855762) has the molecular formula C13H13N5O3 and a molecular weight of 287.28 g/mol. Its IUPAC name is 8-(2-methoxy-3-pyridinyl)-3,7-dimethylpurine-2,6-dione.
| Compound Name | 8-(2-methoxy-3-pyridinyl)-3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 56855762 |
| Molecular Formula | C13H13N5O3 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 8-(2-methoxy-3-pyridinyl)-3,7-dimethylpurine-2,6-dione |
| SMILES | COc1ncccc1-c1nc2c(c(=O)[nH]c(=O)n2C)n1C |
| InChI | InChI=1S/C13H13N5O3/c1-17-8-10(18(2)13(20)16-11(8)19)15-9(17)7-5-4-6-14-12(7)21-3/h4-6H,1-3H3,(H,16,19,20) |
| InChIKey | AVXBBKCAVRZSFR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 94.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |