C18H18N6O3 — CID 134706216
3,7-dimethyl-8-(2-quinolin-8-yloxyethylamino)purine-2,6-dione (PubChem CID 134706216) has the molecular formula C18H18N6O3 and a molecular weight of 366.38 g/mol. Its IUPAC name is 3,7-dimethyl-8-(2-quinolin-8-yloxyethylamino)purine-2,6-dione.
| Compound Name | 3,7-dimethyl-8-(2-quinolin-8-yloxyethylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 134706216 |
| Molecular Formula | C18H18N6O3 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3,7-dimethyl-8-(2-quinolin-8-yloxyethylamino)purine-2,6-dione |
| SMILES | Cn1c(NCCOc2cccc3cccnc23)nc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C18H18N6O3/c1-23-14-15(24(2)18(26)22-16(14)25)21-17(23)20-9-10-27-12-7-3-5-11-6-4-8-19-13(11)12/h3-8H,9-10H2,1-2H3,(H,20,21)(H,22,25,26) |
| InChIKey | ZLEKPZYSPJNWBH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 106.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|