C10H6Cl2N4O2S — CID 107963375
8-(2,5-dichlorothiophen-3-yl)-3-methyl-7H-purine-2,6-dione (PubChem CID 107963375) has the molecular formula C10H6Cl2N4O2S and a molecular weight of 317.16 g/mol. Its IUPAC name is 8-(2,5-dichlorothiophen-3-yl)-3-methyl-7H-purine-2,6-dione.
| Compound Name | 8-(2,5-dichlorothiophen-3-yl)-3-methyl-7H-purine-2,6-dione |
|---|---|
| PubChem CID | 107963375 |
| Molecular Formula | C10H6Cl2N4O2S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 315.96 |
| IUPAC Name | 8-(2,5-dichlorothiophen-3-yl)-3-methyl-7H-purine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2[nH]c(-c3cc(Cl)sc3Cl)nc21 |
| InChI | InChI=1S/C10H6Cl2N4O2S/c1-16-8-5(9(17)15-10(16)18)13-7(14-8)3-2-4(11)19-6(3)12/h2H,1H3,(H,13,14)(H,15,17,18) |
| InChIKey | FMYKRLWKBVQDOK-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |