C8H6N4O2 — CID 70142897
9-ethynyl-3-methylpurine-2,6-dione (PubChem CID 70142897) has the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. Its IUPAC name is 9-ethynyl-3-methylpurine-2,6-dione.
| Compound Name | 9-ethynyl-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 70142897 |
| Molecular Formula | C8H6N4O2 |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | 9-ethynyl-3-methylpurine-2,6-dione |
| SMILES | C#Cn1cnc2c(=O)[nH]c(=O)n(C)c21 |
| InChI | InChI=1S/C8H6N4O2/c1-3-12-4-9-5-6(13)10-8(14)11(2)7(5)12/h1,4H,2H3,(H,10,13,14) |
| InChIKey | FPJFMLAIIOBOKJ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|