C14H11BrN4O3 — CID 979010
9-[2-(4-bromophenyl)-2-oxoethyl]-3-methylpurine-2,6-dione (PubChem CID 979010) has the molecular formula C14H11BrN4O3 and a molecular weight of 363.17 g/mol. Its IUPAC name is 9-[2-(4-bromophenyl)-2-oxoethyl]-3-methylpurine-2,6-dione.
| Compound Name | 9-[2-(4-bromophenyl)-2-oxoethyl]-3-methylpurine-2,6-dione |
|---|---|
| PubChem CID | 979010 |
| Molecular Formula | C14H11BrN4O3 |
| Molecular Weight | 363.17 g/mol |
| Exact Mass | 362.00 |
| IUPAC Name | 9-[2-(4-bromophenyl)-2-oxoethyl]-3-methylpurine-2,6-dione |
| SMILES | Cn1c(=O)[nH]c(=O)c2ncn(CC(=O)c3ccc(Br)cc3)c21 |
| InChI | InChI=1S/C14H11BrN4O3/c1-18-13-11(12(21)17-14(18)22)16-7-19(13)6-10(20)8-2-4-9(15)5-3-8/h2-5,7H,6H2,1H3,(H,17,21,22) |
| InChIKey | UWMDDPHYRMRVHS-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 89.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.17 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |