C14H9BrN4O2S — CID 135585432
2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3H-pteridin-4-one (PubChem CID 135585432) has the molecular formula C14H9BrN4O2S and a molecular weight of 377.22 g/mol. Its IUPAC name is 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3H-pteridin-4-one.
| Compound Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3H-pteridin-4-one |
|---|---|
| PubChem CID | 135585432 |
| Molecular Formula | C14H9BrN4O2S |
| Molecular Weight | 377.22 g/mol |
| Exact Mass | 375.96 |
| IUPAC Name | 2-[2-(4-bromophenyl)-2-oxoethyl]sulfanyl-3H-pteridin-4-one |
| SMILES | O=C(CSc1nc2nccnc2c(=O)[nH]1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H9BrN4O2S/c15-9-3-1-8(2-4-9)10(20)7-22-14-18-12-11(13(21)19-14)16-5-6-17-12/h1-6H,7H2,(H,17,18,19,21) |
| InChIKey | OLCAFPAIZFNGFR-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |