C17H12N4O2 — CID 142636017
3,9-diphenylpurine-2,6-dione (PubChem CID 142636017) has the molecular formula C17H12N4O2 and a molecular weight of 304.31 g/mol. Its IUPAC name is 3,9-diphenylpurine-2,6-dione.
| Compound Name | 3,9-diphenylpurine-2,6-dione |
|---|---|
| PubChem CID | 142636017 |
| Molecular Formula | C17H12N4O2 |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 3,9-diphenylpurine-2,6-dione |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c2c1ncn2-c1ccccc1 |
| InChI | InChI=1S/C17H12N4O2/c22-15-14-16(20(11-18-14)12-7-3-1-4-8-12)21(17(23)19-15)13-9-5-2-6-10-13/h1-11H,(H,19,22,23) |
| InChIKey | ZJJQDQHTUDFTRH-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |