C15H11N3O3 — CID 154294486
1-(4-phenoxyphenyl)-1,3,5-triazine-2,4-dione (PubChem CID 154294486) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 1-(4-phenoxyphenyl)-1,3,5-triazine-2,4-dione.
| Compound Name | 1-(4-phenoxyphenyl)-1,3,5-triazine-2,4-dione |
|---|---|
| PubChem CID | 154294486 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 1-(4-phenoxyphenyl)-1,3,5-triazine-2,4-dione |
| SMILES | O=c1ncn(-c2ccc(Oc3ccccc3)cc2)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11N3O3/c19-14-16-10-18(15(20)17-14)11-6-8-13(9-7-11)21-12-4-2-1-3-5-12/h1-10H,(H,17,19,20) |
| InChIKey | HABDMYRPNMADFM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |