C18H21N5O3 — CID 136991267
tert-butyl 2-[methyl-(6-oxo-9-phenyl-1H-purin-2-yl)amino]acetate (PubChem CID 136991267) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is tert-butyl 2-[methyl-(6-oxo-9-phenyl-1H-purin-2-yl)amino]acetate.
| Compound Name | tert-butyl 2-[methyl-(6-oxo-9-phenyl-1H-purin-2-yl)amino]acetate |
|---|---|
| PubChem CID | 136991267 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | tert-butyl 2-[methyl-(6-oxo-9-phenyl-1H-purin-2-yl)amino]acetate |
| SMILES | CN(CC(=O)OC(C)(C)C)c1nc2c(ncn2-c2ccccc2)c(=O)[nH]1 |
| InChI | InChI=1S/C18H21N5O3/c1-18(2,3)26-13(24)10-22(4)17-20-15-14(16(25)21-17)19-11-23(15)12-8-6-5-7-9-12/h5-9,11H,10H2,1-4H3,(H,20,21,25) |
| InChIKey | RPJKLNSTOFMUQO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 93.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |