2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid

C11H8N4O5S — CID 130302539

IUPAC2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid
SMILESO=c1[nH]c(=O)n(-c2ccccc2)c2nc(S(=O)(=O)O)[nH]c12
InChIInChI=1S/C11H8N4O5S/c16-9-7-8(13-10(12-7)21(18,19)20)15(11(17)14-9)6-4-2-1-3-5-6/h1-5H,(H,12,13)(H,14,16,17)(H,18,19,20)
InChIKeyLONBIODFZWGYTP-UHFFFAOYSA-N
MW308.27 g/mol
LogP-0.35
Rot. Bonds2

About 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid

2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid (PubChem CID 130302539) has the molecular formula C11H8N4O5S and a molecular weight of 308.27 g/mol. Its IUPAC name is 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid.

Molecular Properties

Compound Name2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid
PubChem CID130302539
Molecular FormulaC11H8N4O5S
Molecular Weight308.27 g/mol
Exact Mass308.02
IUPAC Name2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid
SMILESO=c1[nH]c(=O)n(-c2ccccc2)c2nc(S(=O)(=O)O)[nH]c12
InChIInChI=1S/C11H8N4O5S/c16-9-7-8(13-10(12-7)21(18,19)20)15(11(17)14-9)6-4-2-1-3-5-6/h1-5H,(H,12,13)(H,14,16,17)(H,18,19,20)
InChIKeyLONBIODFZWGYTP-UHFFFAOYSA-N
XLogP-0.35
TPSA137.91 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.27
LogP ≤ 5-0.35
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid?
The IUPAC name of 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid (CID 130302539) is 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid.
What is the SMILES notation for 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid?
The canonical SMILES for 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid is O=c1[nH]c(=O)n(-c2ccccc2)c2nc(S(=O)(=O)O)[nH]c12.
What is the InChIKey of 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid?
The InChIKey is LONBIODFZWGYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N4O5S/c16-9-7-8(13-10(12-7)21(18,19)20)15(11(17)14-9)6-4-2-1-3-5-6/h1-5H,(H,12,13)(H,14,16,17)(H,18,19,20).
What are the key properties of 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid?
2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid has a molecular weight of 308.27 g/mol, XLogP of -0.35, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid is sourced from PubChem (CID 130302539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).