C11H8N4O5S — CID 130302539
2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid (PubChem CID 130302539) has the molecular formula C11H8N4O5S and a molecular weight of 308.27 g/mol. Its IUPAC name is 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid.
| Compound Name | 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid |
|---|---|
| PubChem CID | 130302539 |
| Molecular Formula | C11H8N4O5S |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.02 |
| IUPAC Name | 2,6-dioxo-3-phenyl-7H-purine-8-sulfonic acid |
| SMILES | O=c1[nH]c(=O)n(-c2ccccc2)c2nc(S(=O)(=O)O)[nH]c12 |
| InChI | InChI=1S/C11H8N4O5S/c16-9-7-8(13-10(12-7)21(18,19)20)15(11(17)14-9)6-4-2-1-3-5-6/h1-5H,(H,12,13)(H,14,16,17)(H,18,19,20) |
| InChIKey | LONBIODFZWGYTP-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 137.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|