C13H11N3O4S — CID 87351841
(2-oxo-3-phenyl-1H-imidazo[4,5-b]pyridin-5-yl) methanesulfonate (PubChem CID 87351841) has the molecular formula C13H11N3O4S and a molecular weight of 305.31 g/mol. Its IUPAC name is (2-oxo-3-phenyl-1H-imidazo[4,5-b]pyridin-5-yl) methanesulfonate.
| Compound Name | (2-oxo-3-phenyl-1H-imidazo[4,5-b]pyridin-5-yl) methanesulfonate |
|---|---|
| PubChem CID | 87351841 |
| Molecular Formula | C13H11N3O4S |
| Molecular Weight | 305.31 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2-oxo-3-phenyl-1H-imidazo[4,5-b]pyridin-5-yl) methanesulfonate |
| SMILES | CS(=O)(=O)Oc1ccc2[nH]c(=O)n(-c3ccccc3)c2n1 |
| InChI | InChI=1S/C13H11N3O4S/c1-21(18,19)20-11-8-7-10-12(15-11)16(13(17)14-10)9-5-3-2-4-6-9/h2-8H,1H3,(H,14,17) |
| InChIKey | HTNRAJTZTBWOCJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 94.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.31 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|