C15H12ClN3O3 — CID 155343707
4-(4-chlorophenyl)-6-ethoxy-1H-pyrido[2,3-b]pyrazine-2,3-dione (PubChem CID 155343707) has the molecular formula C15H12ClN3O3 and a molecular weight of 317.73 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-6-ethoxy-1H-pyrido[2,3-b]pyrazine-2,3-dione.
| Compound Name | 4-(4-chlorophenyl)-6-ethoxy-1H-pyrido[2,3-b]pyrazine-2,3-dione |
|---|---|
| PubChem CID | 155343707 |
| Molecular Formula | C15H12ClN3O3 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-(4-chlorophenyl)-6-ethoxy-1H-pyrido[2,3-b]pyrazine-2,3-dione |
| SMILES | CCOc1ccc2[nH]c(=O)c(=O)n(-c3ccc(Cl)cc3)c2n1 |
| InChI | InChI=1S/C15H12ClN3O3/c1-2-22-12-8-7-11-13(18-12)19(15(21)14(20)17-11)10-5-3-9(16)4-6-10/h3-8H,2H2,1H3,(H,17,20) |
| InChIKey | YPHOXMUWCASIKJ-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|