C18H18N4O4 — CID 169207220
methyl 4-amino-1-(4-aminophenyl)-7-ethoxy-2-oxo-1,8-naphthyridine-3-carboxylate (PubChem CID 169207220) has the molecular formula C18H18N4O4 and a molecular weight of 354.37 g/mol. Its IUPAC name is methyl 4-amino-1-(4-aminophenyl)-7-ethoxy-2-oxo-1,8-naphthyridine-3-carboxylate.
| Compound Name | methyl 4-amino-1-(4-aminophenyl)-7-ethoxy-2-oxo-1,8-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 169207220 |
| Molecular Formula | C18H18N4O4 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | methyl 4-amino-1-(4-aminophenyl)-7-ethoxy-2-oxo-1,8-naphthyridine-3-carboxylate |
| SMILES | CCOc1ccc2c(N)c(C(=O)OC)c(=O)n(-c3ccc(N)cc3)c2n1 |
| InChI | InChI=1S/C18H18N4O4/c1-3-26-13-9-8-12-15(20)14(18(24)25-2)17(23)22(16(12)21-13)11-6-4-10(19)5-7-11/h4-9H,3,19-20H2,1-2H3 |
| InChIKey | AXSULZKZORPINM-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 122.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|