C15H12N4O — CID 168926684
1-methyl-7-phenyl-5H-imidazo[4,5-f]indazol-6-one (PubChem CID 168926684) has the molecular formula C15H12N4O and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-methyl-7-phenyl-5H-imidazo[4,5-f]indazol-6-one.
| Compound Name | 1-methyl-7-phenyl-5H-imidazo[4,5-f]indazol-6-one |
|---|---|
| PubChem CID | 168926684 |
| Molecular Formula | C15H12N4O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 1-methyl-7-phenyl-5H-imidazo[4,5-f]indazol-6-one |
| SMILES | Cn1ncc2cc3[nH]c(=O)n(-c4ccccc4)c3cc21 |
| InChI | InChI=1S/C15H12N4O/c1-18-13-8-14-12(7-10(13)9-16-18)17-15(20)19(14)11-5-3-2-4-6-11/h2-9H,1H3,(H,17,20) |
| InChIKey | DRZAHZOICNWIMI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 55.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |